cas: 400-94-2 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrobenzoyl chloride 95% (CAS 400-94-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A641824-1g |
| cas | 400-94-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 409.31 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 2556.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A641824 |
4-fluoro-3-nitrobenzoyl chloride (CAS 400-94-2) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 4-fluoro-3-nitrobenzoyl chloride. InChIKey: OJNVFOHHRJZBEG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 4-fluoro-3-nitrobenzoyl chloride |
| InChIKey | OJNVFOHHRJZBEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)