CAS 400-94-2 appears in our catalog under these names: 3-Nitro-4-fluorobenzoyl chloride, 95%, 4-Fluoro-3-nitrobenzoyl chloride 95%, 4-Fluoro-3-nitrobenzoyl chloride, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 10g.
4-fluoro-3-nitrobenzoyl chloride (CAS 400-94-2) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 4-fluoro-3-nitrobenzoyl chloride. InChIKey: OJNVFOHHRJZBEG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 4-fluoro-3-nitrobenzoyl chloride |
| InChIKey | OJNVFOHHRJZBEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)