CAS 709-46-6 appears in our catalog under these names: 2-Fluoro-5-nitrobenzoyl chloride 98%, 2-Fluoro-5-nitrobenzoyl chloride, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-fluoro-5-nitrobenzoyl chloride (CAS 709-46-6) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 2-fluoro-5-nitrobenzoyl chloride. InChIKey: SXJNRYPVXFTJOU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 2-fluoro-5-nitrobenzoyl chloride |
| InChIKey | SXJNRYPVXFTJOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)Cl)F |
Computed by PubChem (NCBI)