Products 57750-82-0
CAS 57750-82-0 appears in our catalog under these names: 4-Fluoro-2-nitrobenzoyl chloride, 95%, 4-Fluoro-2-nitrobenzoyl chloride, 95+%, 4-Fluoro-2-nitrobenzoyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-fluoro-2-nitrobenzoyl chloride (CAS 57750-82-0) is a chemical compound with the molecular formula C7H3ClFNO3 and a molecular weight of 203.55 g/mol. IUPAC name: 4-fluoro-2-nitrobenzoyl chloride. InChIKey: NQMGZEFEQXWOAT-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO3 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 4-fluoro-2-nitrobenzoyl chloride |
| InChIKey | NQMGZEFEQXWOAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)