cas: 157662-77-6 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrophenylacetonitrile 95% (CAS 157662-77-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230891-100mg |
| cas | 157662-77-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 782.00 Pln | |
| Ambeed | 10g | 1210.31 Pln | |
| Ambeed | 25g | 2356.19 Pln | |
| Ambeed | 100g | 7379.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A230891 |
2-(4-fluoro-3-nitrophenyl)acetonitrile (CAS 157662-77-6) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 2-(4-fluoro-3-nitrophenyl)acetonitrile. InChIKey: FCOLUCPHJHRTLY-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 2-(4-fluoro-3-nitrophenyl)acetonitrile |
| InChIKey | FCOLUCPHJHRTLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC#N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)