cas: 450-39-5 — see every product listed under this CAS number, including other names
4-Fluoro-4'-methoxybiphenyl, 96% (CAS 450-39-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022551-100MG |
| cas | 450-39-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 500mg | 476.93 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2075.33 Pln | |
| Fluorochem | 10g | 4100.66 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-fluoro-4-(4-methoxyphenyl)benzene (CAS 450-39-5) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-4-(4-methoxyphenyl)benzene. InChIKey: HPHJIGXCDCZLTP-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-4-(4-methoxyphenyl)benzene |
| InChIKey | HPHJIGXCDCZLTP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)