4-Fluorobenzo[b]thiophene-7-carboxylic acid, 95%
cas: 1379164-23-4 — see every product listed under this CAS number, including other names
4-Fluorobenzo[b]thiophene-7-carboxylic acid, 95% (CAS 1379164-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A489524-250mg |
| cas | 1379164-23-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1532.94 Pln | |
| Ambeed | 1g | 4419.88 Pln | |
| BLDpharm | 50mg | 519.84 Pln | |
| BLDpharm | 100mg | 764.20 Pln | |
| BLDpharm | 250mg | 1647.22 Pln | |
| BLDpharm | 1g | 4762.79 Pln | |
| Chemat | 50mg | 501.20 Pln | |
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 1178.00 Pln | |
| Chemat | 1g | 3424.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-fluoro-1-benzothiophene-7-carboxylic acid (CAS 1379164-23-4) is a chemical compound with the molecular formula C9H5FO2S and a molecular weight of 196.20 g/mol. IUPAC name: 4-fluoro-1-benzothiophene-7-carboxylic acid. InChIKey: SOPRMFWHAPJXKL-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2S |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 4-fluoro-1-benzothiophene-7-carboxylic acid |
| InChIKey | SOPRMFWHAPJXKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CSC2=C1C(=O)O)F |
Computed by PubChem (NCBI)
