Products 1431309-15-7

CAS 1431309-15-7 is the registry number for 7-Fluoro-1-benzothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

7-fluoro-1-benzothiophene-3-carboxylic acid (CAS 1431309-15-7) is a chemical compound with the molecular formula C9H5FO2S and a molecular weight of 196.20 g/mol. IUPAC name: 7-fluoro-1-benzothiophene-3-carboxylic acid. InChIKey: JWJATXQZGJLXOE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5FO2S
Molecular weight196.20 g/mol
IUPAC name7-fluoro-1-benzothiophene-3-carboxylic acid
InChIKeyJWJATXQZGJLXOE-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)F)SC=C2C(=O)O

Computed by PubChem (NCBI)