Products 1692290-24-6
CAS 1692290-24-6 is the registry number for 6-Fluorobenzo[b]thiophene-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-fluoro-1-benzothiophene-3-carboxylic acid (CAS 1692290-24-6) is a chemical compound with the molecular formula C9H5FO2S and a molecular weight of 196.20 g/mol. IUPAC name: 6-fluoro-1-benzothiophene-3-carboxylic acid. InChIKey: JVKBFXIZVYAKET-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2S |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 6-fluoro-1-benzothiophene-3-carboxylic acid |
| InChIKey | JVKBFXIZVYAKET-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC=C2C(=O)O |
Computed by PubChem (NCBI)