CAS 142329-23-5 appears in our catalog under these names: 6-Fluoro-1-benzothiophene-2-carboxylic acid, 95%, 6–fluoro–1–benzothiophene–2–carboxylic acid, 6-Fluorobenzo(b)thiophene-2-carboxylic acid, 6-Fluorobenzo[b]thiophene-2-carboxylic Acid, 97%, 97%, 6-Fluorobenzo[b]thiophene-2-carboxylic acid, 98+%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg, 2.5g.
6-fluoro-1-benzothiophene-2-carboxylic acid (CAS 142329-23-5) is a chemical compound with the molecular formula C9H5FO2S and a molecular weight of 196.20 g/mol. IUPAC name: 6-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: KAIFCLLXRYSWNU-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2S |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 6-fluoro-1-benzothiophene-2-carboxylic acid |
| InChIKey | KAIFCLLXRYSWNU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)