4-Fluoroisoquinolin-1-ol, 98%
cas: 1934536-53-4 — see every product listed under this CAS number, including other names
4-Fluoroisoquinolin-1-ol, 98% (CAS 1934536-53-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A524267-250mg |
| cas | 1934536-53-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1077.20 Pln | |
| BLDpharm | 100mg | 419.88 Pln | |
| BLDpharm | 250mg | 625.36 Pln | |
| BLDpharm | 1g | 1469.51 Pln | |
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 1g | 1992.02 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-fluoro-2H-isoquinolin-1-one (CAS 1934536-53-4) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 4-fluoro-2H-isoquinolin-1-one. InChIKey: XUTQWYYUPAMYGV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 4-fluoro-2H-isoquinolin-1-one |
| InChIKey | XUTQWYYUPAMYGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CNC2=O)F |
Computed by PubChem (NCBI)