Products 1934536-53-4
CAS 1934536-53-4 appears in our catalog under these names: 4-Fluoroisoquinolin-1-ol, 4-Fluoroisoquinolin-1-ol, 95%, 4-Fluoroisoquinolin-1-ol 98%, 4-FLUOROISOQUINOLIN-1-OL, 98%, 4-Fluoroisoquinolin-1-ol, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-fluoro-2H-isoquinolin-1-one (CAS 1934536-53-4) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 4-fluoro-2H-isoquinolin-1-one. InChIKey: XUTQWYYUPAMYGV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 4-fluoro-2H-isoquinolin-1-one |
| InChIKey | XUTQWYYUPAMYGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CNC2=O)F |
Computed by PubChem (NCBI)