cas: 480424-94-0 — see every product listed under this CAS number, including other names
4-Formamidophenylboronic acid, pinacol ester, 95+%, 95+% (CAS 480424-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SBB-250mg |
| cas | 480424-94-0 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 496.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide (CAS 480424-94-0) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide. InChIKey: CDYFHMUSLGPPMI-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide |
| InChIKey | CDYFHMUSLGPPMI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC=O |
Computed by PubChem (NCBI)