cas: 861582-93-6 — see every product listed under this CAS number, including other names
4-Formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid, 97% (CAS 861582-93-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A587837-5g |
| cas | 861582-93-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14307.37 Pln | |
| AmBeed | 10g | 21194.95 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid (CAS 861582-93-6) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid. InChIKey: HIHMHNSVINECDT-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| InChIKey | HIHMHNSVINECDT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N1)C)C(=O)O)C=O |
Computed by PubChem (NCBI)