CAS 861582-93-6 appears in our catalog under these names: 4-Formyl-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%, 4-Formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid (CAS 861582-93-6) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid. InChIKey: HIHMHNSVINECDT-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| InChIKey | HIHMHNSVINECDT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N1)C)C(=O)O)C=O |
Computed by PubChem (NCBI)