cas: 380193-74-8 — see every product listed under this CAS number, including other names
4-Formyl-2-methoxyphenyl 2-fluorobenzoate, 95% (CAS 380193-74-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1007406-5g |
| cas | 380193-74-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10733.38 Pln | |
| AmBeed | 10g | 16065.07 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-formyl-2-methoxyphenyl) 2-fluorobenzoate (CAS 380193-74-8) is a chemical compound with the molecular formula C15H11FO4 and a molecular weight of 274.24 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 2-fluorobenzoate. InChIKey: YDBAXJZIROZNMF-UHFFFAOYSA-N.
| Molecular formula | C15H11FO4 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 2-fluorobenzoate |
| InChIKey | YDBAXJZIROZNMF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)