CAS 1261919-29-2 is the registry number for 6-(2-Fluoro-5-methoxycarbonylphenyl)-2-formylphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-fluoro-3-(3-formyl-2-hydroxyphenyl)benzoate (CAS 1261919-29-2) is a chemical compound with the molecular formula C15H11FO4 and a molecular weight of 274.24 g/mol. IUPAC name: methyl 4-fluoro-3-(3-formyl-2-hydroxyphenyl)benzoate. InChIKey: NEKWWIBUUQWZHM-UHFFFAOYSA-N.
| Molecular formula | C15H11FO4 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | methyl 4-fluoro-3-(3-formyl-2-hydroxyphenyl)benzoate |
| InChIKey | NEKWWIBUUQWZHM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)C2=CC=CC(=C2O)C=O |
Computed by PubChem (NCBI)