Products 1365271-46-0

CAS 1365271-46-0 is the registry number for 3-(4-Carboxy-3-fluorophenyl)phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-[3-(carboxymethyl)phenyl]-2-fluorobenzoic acid (CAS 1365271-46-0) is a chemical compound with the molecular formula C15H11FO4 and a molecular weight of 274.24 g/mol. IUPAC name: 4-[3-(carboxymethyl)phenyl]-2-fluorobenzoic acid. InChIKey: NIODETGWERJTOA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11FO4
Molecular weight274.24 g/mol
IUPAC name4-[3-(carboxymethyl)phenyl]-2-fluorobenzoic acid
InChIKeyNIODETGWERJTOA-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C2=CC(=C(C=C2)C(=O)O)F)CC(=O)O

Computed by PubChem (NCBI)