Products 321726-13-0
CAS 321726-13-0 appears in our catalog under these names: 4-Fluoro-benzoic acid 4-formyl-2-methoxy-phenyl ester, 95%, 4-Formyl-2-methoxyphenyl 4-fluorobenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
(4-formyl-2-methoxyphenyl) 4-fluorobenzoate (CAS 321726-13-0) is a chemical compound with the molecular formula C15H11FO4 and a molecular weight of 274.24 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 4-fluorobenzoate. InChIKey: FFZDAPSMYHGRBQ-UHFFFAOYSA-N.
| Molecular formula | C15H11FO4 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 4-fluorobenzoate |
| InChIKey | FFZDAPSMYHGRBQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)
Synonyms:
4-formyl-2-methoxyphenyl 4-fluorobenzoate, (4-formyl-2-methoxyphenyl) 4-fluorobenzoate, benzoic acid, 4-fluoro-, 4-formyl-2-methoxyphenyl ester, 4-Fluoro-benzoic acid 4-formyl-2-methoxy-phenyl ester, Oprea1_067471, Oprea1_359675, 4-formyl-2-methoxyphenyl4-fluorobenzoate, (4-formyl-2-methoxy-phenyl) 4-fluorobenzoate