cas: 59514-86-2 — see every product listed under this CAS number, including other names
4-Hydroxy-1,8-naphthyridin-2(1H)-one, >95%, >95% (CAS 59514-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJIE-100mg |
| cas | 59514-86-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1394.00 Pln | |
| Chemat | 5g | 3544.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
4-hydroxy-1H-1,8-naphthyridin-2-one (CAS 59514-86-2) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-hydroxy-1H-1,8-naphthyridin-2-one. InChIKey: LUORZZNCJWKOSX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-hydroxy-1H-1,8-naphthyridin-2-one |
| InChIKey | LUORZZNCJWKOSX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C=C2O)N=C1 |
Computed by PubChem (NCBI)