cas: 1256958-29-8 — see every product listed under this CAS number, including other names
4-Hydroxy-7-(methylsulfonyl)quinazoline, ≥97%, ≥97% (CAS 1256958-29-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SXCC-1g |
| cas | 1256958-29-8 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2114.00 Pln | |
| Chemat | 10g | 3851.60 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 352.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
7-methylsulfonyl-3H-quinazolin-4-one (CAS 1256958-29-8) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: 7-methylsulfonyl-3H-quinazolin-4-one. InChIKey: ZILHCDJJJXXSRG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 7-methylsulfonyl-3H-quinazolin-4-one |
| InChIKey | ZILHCDJJJXXSRG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)C(=O)NC=N2 |
Computed by PubChem (NCBI)