Products 853723-84-9
CAS 853723-84-9 is the registry number for 1-(2-Thien-2-ylethyl)imidazolidine-2,4,5-trione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione (CAS 853723-84-9) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: 1-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione. InChIKey: IDYWZSYRNZHKBR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 1-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione |
| InChIKey | IDYWZSYRNZHKBR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CCN2C(=O)C(=O)NC2=O |
Computed by PubChem (NCBI)