CAS 18336-38-4 is the registry number for 4-(Pyrazol-1-yl)benzenesulfonic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-pyrazol-1-ylbenzenesulfonic acid (CAS 18336-38-4) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: 4-pyrazol-1-ylbenzenesulfonic acid. InChIKey: WBRLZNMOGQIRLT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 4-pyrazol-1-ylbenzenesulfonic acid |
| InChIKey | WBRLZNMOGQIRLT-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)