Products 18336-38-4

CAS 18336-38-4 is the registry number for 4-(Pyrazol-1-yl)benzenesulfonic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-pyrazol-1-ylbenzenesulfonic acid (CAS 18336-38-4) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: 4-pyrazol-1-ylbenzenesulfonic acid. InChIKey: WBRLZNMOGQIRLT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O3S
Molecular weight224.24 g/mol
IUPAC name4-pyrazol-1-ylbenzenesulfonic acid
InChIKeyWBRLZNMOGQIRLT-UHFFFAOYSA-N
SMILESC1=CN(N=C1)C2=CC=C(C=C2)S(=O)(=O)O

Computed by PubChem (NCBI)