CAS 439138-78-0 appears in our catalog under these names: 3,5-Dimethyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylic acid, 95%, 3,5-Dimethyl-4-oxo-3,4-dihydro-thieno(2,3-d)-pyrimidine-6-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 0,5g.
3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 439138-78-0) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: UXEKRAQXZUUDCB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | UXEKRAQXZUUDCB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C=N2)C)C(=O)O |
Computed by PubChem (NCBI)