CAS 56083-03-5 appears in our catalog under these names: 4-Hydroxylonchocarpin/ 99.34% (existing batch purity), Isobavachromene, 4-Hydroxylonchocarpin, 99.28%, ISOBAVACHROMENE, 99%. Offered by: TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 20mg, 10 mg, 5 mg.
(E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 56083-03-5) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: IQHPDUUSMBMDGN-WEVVVXLNSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | IQHPDUUSMBMDGN-WEVVVXLNSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2O)C(=O)/C=C/C3=CC=C(C=C3)O)C |
Computed by PubChem (NCBI)