cas: 2096341-83-0 — see every product listed under this CAS number, including other names
4-ISOBUTYRYLPHENYLBORONIC ACID PINACOL ESTER, 98%, 98% (CAS 2096341-83-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHCX-1g |
| cas | 2096341-83-0 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 472.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one (CAS 2096341-83-0) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 2-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one. InChIKey: NHIQIMZJZLXMDB-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 2-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one |
| InChIKey | NHIQIMZJZLXMDB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)C(C)C |
Computed by PubChem (NCBI)