Products 41252-97-5
CAS 41252-97-5 appears in our catalog under these names: 4-Iodo-2-nitrotoluene, 97% , 4–Iodo–2–nitrotoluene, 4-Iodo-2-nitrotoluene, >98.0%(GC), 4-Iodo-2-nitrotoluene 98%, 4-Iodo-2-nitrotoluene, 98%, 98%. Offered by: Thermo Scientific (Alfa Aesar), GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 500g, 10g, 50g, 250g.
4-iodo-1-methyl-2-nitrobenzene (CAS 41252-97-5) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 4-iodo-1-methyl-2-nitrobenzene. InChIKey: QLMRDNPXYNJQMQ-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 4-iodo-1-methyl-2-nitrobenzene |
| InChIKey | QLMRDNPXYNJQMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)