4-Methoxy-3-(trifluoromethyl)phenol 96%
cas: 53903-59-6 — see every product listed under this CAS number, including other names
4-Methoxy-3-(trifluoromethyl)phenol 96% (CAS 53903-59-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A849954-100mg |
| cas | 53903-59-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 2028.00 Pln | |
| Ambeed | 10g | 3502.06 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A849954 |
4-methoxy-3-(trifluoromethyl)phenol (CAS 53903-59-6) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 4-methoxy-3-(trifluoromethyl)phenol. InChIKey: SSPYTHVQEXWESL-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 4-methoxy-3-(trifluoromethyl)phenol |
| InChIKey | SSPYTHVQEXWESL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)O)C(F)(F)F |
Computed by PubChem (NCBI)