cas: 874959-97-4 — see every product listed under this CAS number, including other names
4-Methoxy-3-pyridine boronic acid hydrochloride, 96% (CAS 874959-97-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024643-1G |
| cas | 874959-97-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 2.5g | 581.06 Pln | |
| Fluorochem | 5g | 1039.24 Pln | |
| Fluorochem | 10g | 1976.41 Pln | |
| Fluorochem | 25g | 4855.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(4-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 874959-97-4) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (4-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: JLONCHBPEIKTEA-UHFFFAOYSA-N.
| Molecular formula | C6H9BClNO3 |
|---|---|
| Molecular weight | 189.41 g/mol |
| IUPAC name | (4-methoxy-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | JLONCHBPEIKTEA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)OC)(O)O.Cl |
Computed by PubChem (NCBI)