Products 874959-97-4

CAS 874959-97-4 appears in our catalog under these names: 4-Methoxypyridine-3-boronic acid hydrochloride, 98%, (4-Methoxypyridin-3-yl)boronic acid hydrochloride 98%, 4-Methoxy-3-pyridine boronic acid hydrochloride, 96%, (4-Methoxypyridin-3-yl)boronic acid hydrochloride, 96%, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 2.5g, 25g, 100mg.

Structural formula: {0} (CAS {1})

(4-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 874959-97-4) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (4-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: JLONCHBPEIKTEA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BClNO3
Molecular weight189.41 g/mol
IUPAC name(4-methoxy-3-pyridinyl)boronic acid;hydrochloride
InChIKeyJLONCHBPEIKTEA-UHFFFAOYSA-N
SMILESB(C1=C(C=CN=C1)OC)(O)O.Cl

Computed by PubChem (NCBI)