CAS 874959-97-4 appears in our catalog under these names: 4-Methoxypyridine-3-boronic acid hydrochloride, 98%, 4-Methoxy-3-pyridine boronic acid hydrochloride, 96%, (4-Methoxypyridin-3-yl)boronic acid hydrochloride, 98%, (4-Methoxypyridin-3-yl)boronic acid hydrochloride, 96%, 96%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 2.5g, 250mg, 100mg.
(4-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 874959-97-4) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (4-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: JLONCHBPEIKTEA-UHFFFAOYSA-N.
| Molecular formula | C6H9BClNO3 |
|---|---|
| Molecular weight | 189.41 g/mol |
| IUPAC name | (4-methoxy-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | JLONCHBPEIKTEA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)OC)(O)O.Cl |
Computed by PubChem (NCBI)