Products 370864-57-6

CAS 370864-57-6 is the registry number for 2-Methoxypyridine-5-boronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.

Structural formula: {0} (CAS {1})

(6-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 370864-57-6) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (6-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: ONRXOFWLDRHAFP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BClNO3
Molecular weight189.41 g/mol
IUPAC name(6-methoxy-3-pyridinyl)boronic acid;hydrochloride
InChIKeyONRXOFWLDRHAFP-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)OC)(O)O.Cl

Computed by PubChem (NCBI)