CAS 370864-57-6 is the registry number for 2-Methoxypyridine-5-boronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(6-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 370864-57-6) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (6-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: ONRXOFWLDRHAFP-UHFFFAOYSA-N.
| Molecular formula | C6H9BClNO3 |
|---|---|
| Molecular weight | 189.41 g/mol |
| IUPAC name | (6-methoxy-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | ONRXOFWLDRHAFP-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OC)(O)O.Cl |
Computed by PubChem (NCBI)