Products 2304634-31-7

CAS 2304634-31-7 appears in our catalog under these names: 2-Methoxypyridine-4-boronic acid hydrochloride, 98%, 2-Methoxypyridine-4-boronic acid hydrochloride, 95+%, 95+%, 2-Methoxypyridine-4-boronic acid hydrochloride, 95+%, (2-Methoxypyridin-4-yl)boronic acid hydrochloride, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2-methoxy-4-pyridinyl)boronic acid;hydrochloride (CAS 2304634-31-7) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (2-methoxy-4-pyridinyl)boronic acid;hydrochloride. InChIKey: RSHDOVPDBWJNNM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BClNO3
Molecular weight189.41 g/mol
IUPAC name(2-methoxy-4-pyridinyl)boronic acid;hydrochloride
InChIKeyRSHDOVPDBWJNNM-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1)OC)(O)O.Cl

Computed by PubChem (NCBI)