cas: 88686-30-0 — see every product listed under this CAS number, including other names
4-Methoxy-7-methyl-1,3-benzothiazol-2-amine, 95%, 95% (CAS 88686-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1158UE-100mg |
| cas | 88686-30-0 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 904.40 Pln | |
| Chemat | 5g | 2896.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-7-methyl-1,3-benzothiazol-2-amine (CAS 88686-30-0) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 4-methoxy-7-methyl-1,3-benzothiazol-2-amine. InChIKey: BPFSLCTUFLBWNK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-methoxy-7-methyl-1,3-benzothiazol-2-amine |
| InChIKey | BPFSLCTUFLBWNK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC)N=C(S2)N |
Computed by PubChem (NCBI)