4-Methoxybiphenyl, 98%
cas: 613-37-6 — see every product listed under this CAS number, including other names
4-Methoxybiphenyl, 98% (CAS 613-37-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114LNJ-1g |
| cas | 613-37-6 |
| size | 1g |
| availability | 572.8g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 50g | 405.20 Pln | |
| Chemat | 100g | 731.60 Pln | |
| Chemat | 250g | 1509.20 Pln | |
| Chemat | 500g | 2563.20 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1148.57 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methoxy-4-phenylbenzene (CAS 613-37-6) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 1-methoxy-4-phenylbenzene. InChIKey: RHDYQUZYHZWTCI-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 1-methoxy-4-phenylbenzene |
| InChIKey | RHDYQUZYHZWTCI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)