cas: 3951-10-8 — see every product listed under this CAS number, including other names
4-Methoxyphenylacetic Anhydride, >98.0%(T) (CAS 3951-10-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M0968-25G |
| cas | 3951-10-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 197.02 Pln | |
| TCI | 500g | 1623.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
[2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate (CAS 3951-10-8) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: [2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate. InChIKey: KYCAEIXHUXBNTQ-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | [2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate |
| InChIKey | KYCAEIXHUXBNTQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC(=O)OC(=O)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)