CAS 36685-67-3 appears in our catalog under these names: 2'-Hydroxy-2,4,4'-trimethoxychalcone, 95%, 2'-Hydroxy-2,4,4'-trimethoxychalcone, 2'-Hydroxy-2,4,4'-trimethoxychalcone, min. 95 %, 50 mg, 2'-Hydroxy-2,4,4'-trimethoxychalcone, min. 95 %, 100 mg, 2'-Hydroxy-2,4,4'-trimethoxychalcone, min. 95 %, 250 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 50mg.
(E)-3-(2,4-dimethoxyphenyl)-1-(2-hydroxy-4-methoxyphenyl)prop-2-en-1-one (CAS 36685-67-3) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: (E)-3-(2,4-dimethoxyphenyl)-1-(2-hydroxy-4-methoxyphenyl)prop-2-en-1-one. InChIKey: ZTIPWOFLPVWZDX-WEVVVXLNSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | (E)-3-(2,4-dimethoxyphenyl)-1-(2-hydroxy-4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | ZTIPWOFLPVWZDX-WEVVVXLNSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)/C=C/C2=C(C=C(C=C2)OC)OC)O |
Computed by PubChem (NCBI)