Products 1416339-27-9

CAS 1416339-27-9 is the registry number for 5-Acetyl-2-(4-methoxy-benzyloxy)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5-acetyl-2-[(4-methoxyphenyl)methoxy]benzoate (CAS 1416339-27-9) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: methyl 5-acetyl-2-[(4-methoxyphenyl)methoxy]benzoate. InChIKey: LRRHHVWUVREEBI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18O5
Molecular weight314.3 g/mol
IUPAC namemethyl 5-acetyl-2-[(4-methoxyphenyl)methoxy]benzoate
InChIKeyLRRHHVWUVREEBI-UHFFFAOYSA-N
SMILESCC(=O)C1=CC(=C(C=C1)OCC2=CC=C(C=C2)OC)C(=O)OC

Computed by PubChem (NCBI)