Products 1951439-96-5

CAS 1951439-96-5 is the registry number for Di(4-carboxymethyl)benzyl ether, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

2-[4-[[4-(carboxymethyl)phenyl]methoxymethyl]phenyl]acetic acid (CAS 1951439-96-5) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 2-[4-[[4-(carboxymethyl)phenyl]methoxymethyl]phenyl]acetic acid. InChIKey: XHTBGKWWMRINLH-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18O5
Molecular weight314.3 g/mol
IUPAC name2-[4-[[4-(carboxymethyl)phenyl]methoxymethyl]phenyl]acetic acid
InChIKeyXHTBGKWWMRINLH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)O)COCC2=CC=C(C=C2)CC(=O)O

Computed by PubChem (NCBI)