4-Methyl-1H-indole-2-carboxylic acid, 97%
cas: 18474-57-2 — see every product listed under this CAS number, including other names
4-Methyl-1H-indole-2-carboxylic acid, 97% (CAS 18474-57-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A189723-100mg |
| cas | 18474-57-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 937.75 Pln | |
| Ambeed | 25g | 3457.56 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 864.16 Pln | |
| BLDpharm | 25g | 3724.27 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-methyl-1H-indole-2-carboxylic acid (CAS 18474-57-2) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4-methyl-1H-indole-2-carboxylic acid. InChIKey: QMSCXKCJGFIXDF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-methyl-1H-indole-2-carboxylic acid |
| InChIKey | QMSCXKCJGFIXDF-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(NC2=CC=C1)C(=O)O |
Computed by PubChem (NCBI)