cas: 1249834-47-6 — see every product listed under this CAS number, including other names
4-Methyl-2-phenyl-1,3-thiazol-5-amine 95% (CAS 1249834-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1037876-100mg |
| cas | 1249834-47-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 2089.19 Pln | |
| Ambeed | 5g | 7156.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1037876 |
4-methyl-2-phenyl-1,3-thiazol-5-amine (CAS 1249834-47-6) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-methyl-2-phenyl-1,3-thiazol-5-amine. InChIKey: LYUISGYCYRYZPX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-methyl-2-phenyl-1,3-thiazol-5-amine |
| InChIKey | LYUISGYCYRYZPX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)