cas: 42308-28-1 — see every product listed under this CAS number, including other names
4-Methyl-2-phenylaniline, 98% (CAS 42308-28-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633241-250MG |
| cas | 42308-28-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 1783.76 Pln | |
| Fluorochem | 5g | 3434.23 Pln | |
| Fluorochem | 10g | 6219.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-methyl-2-phenylaniline (CAS 42308-28-1) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-methyl-2-phenylaniline. InChIKey: KUDNAOXIFNMHEK-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-methyl-2-phenylaniline |
| InChIKey | KUDNAOXIFNMHEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)