cas: 42308-28-1 — see every product listed under this CAS number, including other names
5-Methylbiphenyl-2-amine, ≥97-<99% (CAS 42308-28-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6734-97-99-5g |
| cas | 42308-28-1 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 7664.14 Pln | |
| Hoffman Fine Chemicals | 10g | 12079.10 Pln | |
| Hoffman Fine Chemicals | 25g | 23850.20 Pln | |
| Hoffman Fine Chemicals | 50g | 37969.14 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-methyl-2-phenylaniline (CAS 42308-28-1) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-methyl-2-phenylaniline. InChIKey: KUDNAOXIFNMHEK-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-methyl-2-phenylaniline |
| InChIKey | KUDNAOXIFNMHEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)