cas: 124401-38-3 — see every product listed under this CAS number, including other names
4-Methyl-3-oxo-N-phenylpentanamide, 97% (CAS 124401-38-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225169-1G |
| cas | 124401-38-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 560.24 Pln | |
| Fluorochem | 25g | 940.31 Pln | |
| Fluorochem | 100g | 3288.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-methyl-3-oxo-N-phenylpentanamide (CAS 124401-38-3) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 4-methyl-3-oxo-N-phenylpentanamide. InChIKey: ADHRFDCBLJVNFO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 4-methyl-3-oxo-N-phenylpentanamide |
| InChIKey | ADHRFDCBLJVNFO-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)