cas: 50650-75-4 — see every product listed under this CAS number, including other names
4-Methyl-6-(2,4,4-trimethylpentyl)-2H-pyran-2-one, 95%+, 95%+ (CAS 50650-75-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBRQ-100mg |
| cas | 50650-75-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-methyl-6-(2,4,4-trimethylpentyl)pyran-2-one (CAS 50650-75-4) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-methyl-6-(2,4,4-trimethylpentyl)pyran-2-one. InChIKey: LMCDKONPVQNISE-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-methyl-6-(2,4,4-trimethylpentyl)pyran-2-one |
| InChIKey | LMCDKONPVQNISE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC(=C1)CC(C)CC(C)(C)C |
Computed by PubChem (NCBI)