cas: 50650-75-4 — see every product listed under this CAS number, including other names
4-Methyl-6-(2,4,4-trimethylpentyl)-2H-pyran-2-one (CAS 50650-75-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F774277-250MG |
| cas | 50650-75-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 3501.91 Pln |
| delivery time | 3-4 weeks |
|---|
4-methyl-6-(2,4,4-trimethylpentyl)pyran-2-one (CAS 50650-75-4) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-methyl-6-(2,4,4-trimethylpentyl)pyran-2-one. InChIKey: LMCDKONPVQNISE-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-methyl-6-(2,4,4-trimethylpentyl)pyran-2-one |
| InChIKey | LMCDKONPVQNISE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC(=C1)CC(C)CC(C)(C)C |
Computed by PubChem (NCBI)