cas: 19158-51-1 — see every product listed under this CAS number, including other names
4-Methylbenzenesulfonyl cyanide 98% (CAS 19158-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A741146-1g |
| cas | 19158-51-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 748.62 Pln | |
| Ambeed | 100g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A741146 |
(4-methylphenyl)sulfonylformonitrile (CAS 19158-51-1) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: (4-methylphenyl)sulfonylformonitrile. InChIKey: JONIMGVUGJVFQD-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | (4-methylphenyl)sulfonylformonitrile |
| InChIKey | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C#N |
Computed by PubChem (NCBI)