cas: 19158-51-1 — see every product listed under this CAS number, including other names
4-Methylbenzenesulfonyl cyanide (CAS 19158-51-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209864-100MG |
| cas | 19158-51-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 534.20 Pln | |
| Fluorochem | 25g | 1049.65 Pln |
| delivery time | 3-4 weeks |
|---|
(4-methylphenyl)sulfonylformonitrile (CAS 19158-51-1) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: (4-methylphenyl)sulfonylformonitrile. InChIKey: JONIMGVUGJVFQD-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | (4-methylphenyl)sulfonylformonitrile |
| InChIKey | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C#N |
Computed by PubChem (NCBI)