cas: 457931-46-3 — see every product listed under this CAS number, including other names
4-Methylphenyl 1-thio-α-D-mannopyranoside (CAS 457931-46-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 2g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM32830C-1g |
| cas | 457931-46-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4598.01 Pln | |
| Chemat | 250mg | 1929.08 Pln | |
| Chemat | 2g | 6971.90 Pln | |
| Chemat | 500mg | 2918.15 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol (CAS 457931-46-3) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol. InChIKey: IQCLIQLFPVKINX-NAWOPXAZSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol |
| InChIKey | IQCLIQLFPVKINX-NAWOPXAZSA-N |
| SMILES | CC1=CC=C(C=C1)S[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)