cas: 6973-51-9 — see every product listed under this CAS number, including other names
4-Nitrobenzo[d]thiazol-2-amine, 97% (CAS 6973-51-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091546-100MG |
| cas | 6973-51-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1794.18 Pln | |
| Fluorochem | 10g | 2918.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-nitro-1,3-benzothiazol-2-amine (CAS 6973-51-9) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 4-nitro-1,3-benzothiazol-2-amine. InChIKey: XPYJFCKUPMJFHE-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 4-nitro-1,3-benzothiazol-2-amine |
| InChIKey | XPYJFCKUPMJFHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)