CAS 84987-89-3 is the registry number for 3-AMINO-5-NITROBENZISOTHIAZOLE, 97%. Offered by: Sigma-Aldrich. Available pack sizes: 5G.
5-nitro-1,2-benzothiazol-3-amine (CAS 84987-89-3) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-nitro-1,2-benzothiazol-3-amine. InChIKey: LDTCWISGJYTXDC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-nitro-1,2-benzothiazol-3-amine |
| InChIKey | LDTCWISGJYTXDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=NS2)N |
Computed by PubChem (NCBI)